C16H25NO — CID 158141664
(4aS,6S,8aR)-6-ethyl-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole (PubChem CID 158141664) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (4aS,6S,8aR)-6-ethyl-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole.
| Compound Name | (4aS,6S,8aR)-6-ethyl-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole |
|---|---|
| PubChem CID | 158141664 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (4aS,6S,8aR)-6-ethyl-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole |
| SMILES | CC[C@H]1CC[C@H]2C(C)(C)c3oncc3C[C@]2(C)C1 |
| InChI | InChI=1S/C16H25NO/c1-5-11-6-7-13-15(2,3)14-12(10-17-18-14)9-16(13,4)8-11/h10-11,13H,5-9H2,1-4H3/t11-,13-,16-/m0/s1 |
| InChIKey | NGYWOMJBCBMTHP-RBOXIYTFSA-N |
| XLogP | 4.34 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |