About 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane
2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane (PubChem CID 158141980) has the molecular formula C12H18ClN3S
and a molecular weight of 271.82 g/mol. Its IUPAC name is 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane.
Molecular Properties
| Compound Name | 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane |
| PubChem CID | 158141980 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane |
| SMILES | C.CC1(Nc2nc(Cl)nc3c2SCC3)CCC1 |
| InChI | InChI=1S/C11H14ClN3S.CH4/c1-11(4-2-5-11)15-9-8-7(3-6-16-8)13-10(12)14-9;/h2-6H2,1H3,(H,13,14,15);1H4 |
| InChIKey | FUAYTBRMPHKHQH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane?
The IUPAC name of 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane (CID 158141980) is 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane.
What is the SMILES notation for 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane?
The canonical SMILES for 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane is C.CC1(Nc2nc(Cl)nc3c2SCC3)CCC1.
What is the InChIKey of 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane?
The InChIKey is FUAYTBRMPHKHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN3S.CH4/c1-11(4-2-5-11)15-9-8-7(3-6-16-8)13-10(12)14-9;/h2-6H2,1H3,(H,13,14,15);1H4.
What are the key properties of 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane?
2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane has a molecular weight of 271.82 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1-methylcyclobutyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;methane is sourced from PubChem (CID 158141980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).