C29H52O3Si — CID 158142217
[(3aR,4R,5R,7aS)-5-[(1S,2R,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate (PubChem CID 158142217) has the molecular formula C29H52O3Si and a molecular weight of 476.82 g/mol. Its IUPAC name is [(3aR,4R,5R,7aS)-5-[(1S,2R,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate.
| Compound Name | [(3aR,4R,5R,7aS)-5-[(1S,2R,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 158142217 |
| Molecular Formula | C29H52O3Si |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | [(3aR,4R,5R,7aS)-5-[(1S,2R,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate |
| SMILES | C=C1CC[C@H]2[C@H](OC(C)=O)[C@@H]([C@@]3(C)CC[C@H](C)C[C@@H]3CCO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C29H52O3Si/c1-20-13-16-29(8,23(19-20)15-18-31-33(9,10)27(4,5)6)25-14-17-28(7)21(2)11-12-24(28)26(25)32-22(3)30/h20,23-26H,2,11-19H2,1,3-10H3/t20-,23-,24-,25-,26-,28+,29-/m0/s1 |
| InChIKey | GXSHOLUGXRVMGN-QBJYABPASA-N |
| XLogP | 8.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|