About dihexylazanium;naphthalene-1-carboxylate
dihexylazanium;naphthalene-1-carboxylate (PubChem CID 158142932) has the molecular formula C23H35NO2
and a molecular weight of 357.54 g/mol. Its IUPAC name is dihexylazanium;naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | dihexylazanium;naphthalene-1-carboxylate |
| PubChem CID | 158142932 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | dihexylazanium;naphthalene-1-carboxylate |
| SMILES | CCCCCC[NH2+]CCCCCC.O=C([O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C12H27N.C11H8O2/c1-3-5-7-9-11-13-12-10-8-6-4-2;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h13H,3-12H2,1-2H3;1-7H,(H,12,13) |
| InChIKey | FUDXSPDQEROWJT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dihexylazanium;naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexylazanium;naphthalene-1-carboxylate?
The IUPAC name of dihexylazanium;naphthalene-1-carboxylate (CID 158142932) is dihexylazanium;naphthalene-1-carboxylate.
What is the SMILES notation for dihexylazanium;naphthalene-1-carboxylate?
The canonical SMILES for dihexylazanium;naphthalene-1-carboxylate is CCCCCC[NH2+]CCCCCC.O=C([O-])c1cccc2ccccc12.
What is the InChIKey of dihexylazanium;naphthalene-1-carboxylate?
The InChIKey is FUDXSPDQEROWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.C11H8O2/c1-3-5-7-9-11-13-12-10-8-6-4-2;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h13H,3-12H2,1-2H3;1-7H,(H,12,13).
What are the key properties of dihexylazanium;naphthalene-1-carboxylate?
dihexylazanium;naphthalene-1-carboxylate has a molecular weight of 357.54 g/mol, XLogP of 3.91, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihexylazanium;naphthalene-1-carboxylate is sourced from PubChem (CID 158142932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).