C14H15IN2O3S — CID 15814341
ethyl 3-(7-iodo-5-oxo-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate (PubChem CID 15814341) has the molecular formula C14H15IN2O3S and a molecular weight of 418.26 g/mol. Its IUPAC name is ethyl 3-(7-iodo-5-oxo-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate.
| Compound Name | ethyl 3-(7-iodo-5-oxo-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate |
|---|---|
| PubChem CID | 15814341 |
| Molecular Formula | C14H15IN2O3S |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | ethyl 3-(7-iodo-5-oxo-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate |
| SMILES | CCOC(=O)CCN1CC(=S)Nc2ccc(I)cc2C1=O |
| InChI | InChI=1S/C14H15IN2O3S/c1-2-20-13(18)5-6-17-8-12(21)16-11-4-3-9(15)7-10(11)14(17)19/h3-4,7H,2,5-6,8H2,1H3,(H,16,21) |
| InChIKey | IIUKJAVJQGAGKI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|