C17H19F15O — CID 158144388
9-(3,3-dimethylpent-1-en-2-yloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-(trifluoromethyl)nonane (PubChem CID 158144388) has the molecular formula C17H19F15O and a molecular weight of 524.31 g/mol. Its IUPAC name is 9-(3,3-dimethylpent-1-en-2-yloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-(trifluoromethyl)nonane.
| Compound Name | 9-(3,3-dimethylpent-1-en-2-yloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-(trifluoromethyl)nonane |
|---|---|
| PubChem CID | 158144388 |
| Molecular Formula | C17H19F15O |
| Molecular Weight | 524.31 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 9-(3,3-dimethylpent-1-en-2-yloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-(trifluoromethyl)nonane |
| SMILES | C=C(OCCC(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(C)(C)CC |
| InChI | InChI=1S/C17H19F15O/c1-5-11(3,4)8(2)33-7-6-9(14(24,25)26)12(20,21)15(27,28)17(31,32)16(29,30)13(22,23)10(18)19/h9-10H,2,5-7H2,1,3-4H3 |
| InChIKey | SQJBZMZHZGEYHK-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.31 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|