C24H23F2NO — CID 158144603
[(1S,3R)-3-[3,5-bis(4-fluorophenyl)phenoxy]cyclopentyl]methanamine (PubChem CID 158144603) has the molecular formula C24H23F2NO and a molecular weight of 379.45 g/mol. Its IUPAC name is [(1S,3R)-3-[3,5-bis(4-fluorophenyl)phenoxy]cyclopentyl]methanamine.
| Compound Name | [(1S,3R)-3-[3,5-bis(4-fluorophenyl)phenoxy]cyclopentyl]methanamine |
|---|---|
| PubChem CID | 158144603 |
| Molecular Formula | C24H23F2NO |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [(1S,3R)-3-[3,5-bis(4-fluorophenyl)phenoxy]cyclopentyl]methanamine |
| SMILES | NC[C@H]1CC[C@@H](Oc2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C24H23F2NO/c25-21-6-2-17(3-7-21)19-12-20(18-4-8-22(26)9-5-18)14-24(13-19)28-23-10-1-16(11-23)15-27/h2-9,12-14,16,23H,1,10-11,15,27H2/t16-,23+/m0/s1 |
| InChIKey | RIGGDSKFRFCTJC-QMHKHESXSA-N |
| XLogP | 5.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |