C27H38F2O6S2 — CID 158144893
2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;4-(4-tert-butylphenyl)-1,4-oxathian-4-ium (PubChem CID 158144893) has the molecular formula C27H38F2O6S2 and a molecular weight of 560.73 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;4-(4-tert-butylphenyl)-1,4-oxathian-4-ium.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;4-(4-tert-butylphenyl)-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 158144893 |
| Molecular Formula | C27H38F2O6S2 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;4-(4-tert-butylphenyl)-1,4-oxathian-4-ium |
| SMILES | CC(C)(C)c1ccc([S+]2CCOCC2)cc1.O=C(OCC(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H21OS.C13H18F2O5S/c1-14(2,3)12-4-6-13(7-5-12)16-10-8-15-9-11-16;14-13(15,21(17,18)19)7-20-11(16)12-4-8-1-9(5-12)3-10(2-8)6-12/h4-7H,8-11H2,1-3H3;8-10H,1-7H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | FUJWZVFYJARAIE-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|