C32H20BO2S2 — CID 158144962
CID 158144962 (PubChem CID 158144962) has the molecular formula C32H20BO2S2 and a molecular weight of 511.46 g/mol.
| Compound Name | CID 158144962 |
|---|---|
| PubChem CID | 158144962 |
| Molecular Formula | C32H20BO2S2 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | — |
| SMILES | O[B]Oc1cc2ccccc2c2c1sc1ccccc12.c1ccc2c(c1)ccc1sc3ccccc3c12 |
| InChI | InChI=1S/C16H10BO2S.C16H10S/c18-17-19-13-9-10-5-1-2-6-11(10)15-12-7-3-4-8-14(12)20-16(13)15;1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15/h1-9,18H;1-10H |
| InChIKey | DRKOEZKMZMAUFR-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|