C20H26N4O3 — CID 158148622
7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde (PubChem CID 158148622) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde.
| Compound Name | 7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 158148622 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde |
| SMILES | COC(OC)c1ccc2c(n1)NCCC2.O=Cc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C11H16N2O2.C9H10N2O/c1-14-11(15-2)9-6-5-8-4-3-7-12-10(8)13-9;12-6-8-4-3-7-2-1-5-10-9(7)11-8/h5-6,11H,3-4,7H2,1-2H3,(H,12,13);3-4,6H,1-2,5H2,(H,10,11) |
| InChIKey | FUVBDFVHPJHTHA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|