C12H24O8 — CID 158149113
1,3-dioxane;1,3,7,9-tetraoxacyclododecane-5,11-diol (PubChem CID 158149113) has the molecular formula C12H24O8 and a molecular weight of 296.32 g/mol. Its IUPAC name is 1,3-dioxane;1,3,7,9-tetraoxacyclododecane-5,11-diol.
| Compound Name | 1,3-dioxane;1,3,7,9-tetraoxacyclododecane-5,11-diol |
|---|---|
| PubChem CID | 158149113 |
| Molecular Formula | C12H24O8 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1,3-dioxane;1,3,7,9-tetraoxacyclododecane-5,11-diol |
| SMILES | C1COCOC1.OC1COCOCC(O)COCOC1 |
| InChI | InChI=1S/C8H16O6.C4H8O2/c9-7-1-11-5-13-3-8(10)4-14-6-12-2-7;1-2-5-4-6-3-1/h7-10H,1-6H2;1-4H2 |
| InChIKey | FUWMXVSSQXYBSX-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |