About butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile
butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile (PubChem CID 158149186) has the molecular formula C10H21ClF3NSi2
and a molecular weight of 303.90 g/mol. Its IUPAC name is butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile.
Molecular Properties
| Compound Name | butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile |
| PubChem CID | 158149186 |
| Molecular Formula | C10H21ClF3NSi2 |
| Molecular Weight | 303.90 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile |
| SMILES | CCCC[Si](F)(F)F.C[Si](C)(Cl)CCCC#N |
| InChI | InChI=1S/C6H12ClNSi.C4H9F3Si/c1-9(2,7)6-4-3-5-8;1-2-3-4-8(5,6)7/h3-4,6H2,1-2H3;2-4H2,1H3 |
| InChIKey | FUWTXUWEIZDTEK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile?
The IUPAC name of butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile (CID 158149186) is butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile.
What is the SMILES notation for butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile?
The canonical SMILES for butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile is CCCC[Si](F)(F)F.C[Si](C)(Cl)CCCC#N.
What is the InChIKey of butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile?
The InChIKey is FUWTXUWEIZDTEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNSi.C4H9F3Si/c1-9(2,7)6-4-3-5-8;1-2-3-4-8(5,6)7/h3-4,6H2,1-2H3;2-4H2,1H3.
What are the key properties of butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile?
butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile has a molecular weight of 303.90 g/mol, XLogP of 5.37, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trifluoro)silane;4-[chloro(dimethyl)silyl]butanenitrile is sourced from PubChem (CID 158149186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).