C26H24ClFN2O3 — CID 158149987
1-[[4-[5-chloro-2-[(1R,2S)-2-fluorocyclopentyl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 158149987) has the molecular formula C26H24ClFN2O3 and a molecular weight of 466.94 g/mol. Its IUPAC name is 1-[[4-[5-chloro-2-[(1R,2S)-2-fluorocyclopentyl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[5-chloro-2-[(1R,2S)-2-fluorocyclopentyl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 158149987 |
| Molecular Formula | C26H24ClFN2O3 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-[[4-[5-chloro-2-[(1R,2S)-2-fluorocyclopentyl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(CN4C(=O)CCC4=O)ccc23)c1O[C@@H]1CCC[C@@H]1F |
| InChI | InChI=1S/C26H24ClFN2O3/c1-15-11-17(27)13-20(26(15)33-23-4-2-3-21(23)28)18-9-10-29-22-12-16(5-6-19(18)22)14-30-24(31)7-8-25(30)32/h5-6,9-13,21,23H,2-4,7-8,14H2,1H3/t21-,23+/m0/s1 |
| InChIKey | UCQHLEPJMOMGRE-JTHBVZDNSA-N |
| XLogP | 5.78 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|