C18H26F3NO4S — CID 158150885
4-[4-(4-methylsulfonylphenyl)butyl]piperidine;2,2,2-trifluoroacetic acid (PubChem CID 158150885) has the molecular formula C18H26F3NO4S and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-[4-(4-methylsulfonylphenyl)butyl]piperidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-(4-methylsulfonylphenyl)butyl]piperidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158150885 |
| Molecular Formula | C18H26F3NO4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[4-(4-methylsulfonylphenyl)butyl]piperidine;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)c1ccc(CCCCC2CCNCC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25NO2S.C2HF3O2/c1-20(18,19)16-8-6-14(7-9-16)4-2-3-5-15-10-12-17-13-11-15;3-2(4,5)1(6)7/h6-9,15,17H,2-5,10-13H2,1H3;(H,6,7) |
| InChIKey | FVCBYMYEJLQSIU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|