About 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal
2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal (PubChem CID 158151589) has the molecular formula C14H6Br2O2
and a molecular weight of 366.01 g/mol. Its IUPAC name is 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal.
Molecular Properties
| Compound Name | 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal |
| PubChem CID | 158151589 |
| Molecular Formula | C14H6Br2O2 |
| Molecular Weight | 366.01 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal |
| SMILES | O=CC#CC#CC#CBr.O=Cc1ccccc1Br |
| InChI | InChI=1S/C7H5BrO.C7HBrO/c8-7-4-2-1-3-6(7)5-9;8-6-4-2-1-3-5-7-9/h1-5H;7H |
| InChIKey | FVEHUERAPQXAGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.01 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal?
The IUPAC name of 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal (CID 158151589) is 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal.
What is the SMILES notation for 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal?
The canonical SMILES for 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal is O=CC#CC#CC#CBr.O=Cc1ccccc1Br.
What is the InChIKey of 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal?
The InChIKey is FVEHUERAPQXAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.C7HBrO/c8-7-4-2-1-3-6(7)5-9;8-6-4-2-1-3-5-7-9/h1-5H;7H.
What are the key properties of 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal?
2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal has a molecular weight of 366.01 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzaldehyde;7-bromohepta-2,4,6-triynal is sourced from PubChem (CID 158151589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).