C15H26N4O2 — CID 158151741
3-ethenylpenta-1,3-diene;hexa-1,3,5-triene;urea (PubChem CID 158151741) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-ethenylpenta-1,3-diene;hexa-1,3,5-triene;urea.
| Compound Name | 3-ethenylpenta-1,3-diene;hexa-1,3,5-triene;urea |
|---|---|
| PubChem CID | 158151741 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-ethenylpenta-1,3-diene;hexa-1,3,5-triene;urea |
| SMILES | C=CC(C=C)=CC.C=CC=CC=C.NC(N)=O.NC(N)=O |
| InChI | InChI=1S/C7H10.C6H8.2CH4N2O/c1-4-7(5-2)6-3;1-3-5-6-4-2;2*2-1(3)4/h4-6H,1-2H2,3H3;3-6H,1-2H2;2*(H4,2,3,4) |
| InChIKey | FVESJASILJQVSP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|