C21H39NO10 — CID 158151939
N-[(1S,2R,4R,5S)-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-(2-hydroxypropan-2-yloxy)-2-methyl-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 158151939) has the molecular formula C21H39NO10 and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[(1S,2R,4R,5S)-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-(2-hydroxypropan-2-yloxy)-2-methyl-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,4R,5S)-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-(2-hydroxypropan-2-yloxy)-2-methyl-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 158151939 |
| Molecular Formula | C21H39NO10 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[(1S,2R,4R,5S)-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-(2-hydroxypropan-2-yloxy)-2-methyl-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(OC(C)(C)O)[C@@H](C)[C@]2(COCCOCCOCCOCCO)CO[C@H]1O2 |
| InChI | InChI=1S/C21H39NO10/c1-15-18(31-20(3,4)25)17(22-16(2)24)19-30-14-21(15,32-19)13-29-12-11-28-10-9-27-8-7-26-6-5-23/h15,17-19,23,25H,5-14H2,1-4H3,(H,22,24)/t15-,17-,18?,19+,21+/m1/s1 |
| InChIKey | FVFHHWAUAMWYAM-HEJNNNDQSA-N |
| XLogP | -0.58 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|