C36H38F6N6O7S2 — CID 158152030
[3-[1-[2-oxo-2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate;[3-[1-[2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate (PubChem CID 158152030) has the molecular formula C36H38F6N6O7S2 and a molecular weight of 844.86 g/mol. Its IUPAC name is [3-[1-[2-oxo-2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate;[3-[1-[2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[1-[2-oxo-2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate;[3-[1-[2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158152030 |
| Molecular Formula | C36H38F6N6O7S2 |
| Molecular Weight | 844.86 g/mol |
| Exact Mass | 844.21 |
| IUPAC Name | [3-[1-[2-oxo-2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate;[3-[1-[2-(pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(CN1CCC(c2cccc(OS(=O)(=O)C(F)(F)F)c2)C1)Nc1ccccn1.O=S(=O)(Oc1cccc(C2CCN(CCNc3ccccn3)C2)c1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O4S.C18H20F3N3O3S/c19-18(20,21)29(26,27)28-15-5-3-4-13(10-15)14-7-9-24(11-14)12-17(25)23-16-6-1-2-8-22-16;19-18(20,21)28(25,26)27-16-5-3-4-14(12-16)15-7-10-24(13-15)11-9-23-17-6-1-2-8-22-17/h1-6,8,10,14H,7,9,11-12H2,(H,22,23,25);1-6,8,12,15H,7,9-11,13H2,(H,22,23) |
| InChIKey | FVFNAIVSLRJJQS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.86 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|