About [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane
[(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane (PubChem CID 158152684) has the molecular formula C16H27NO6S
and a molecular weight of 361.46 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane.
Molecular Properties
| Compound Name | [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane |
| PubChem CID | 158152684 |
| Molecular Formula | C16H27NO6S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane |
| SMILES | C.C[C@@](O)(COS(C)(=O)=O)c1ccc(COC2CCCCO2)nc1 |
| InChI | InChI=1S/C15H23NO6S.CH4/c1-15(17,11-22-23(2,18)19)12-6-7-13(16-9-12)10-21-14-5-3-4-8-20-14;/h6-7,9,14,17H,3-5,8,10-11H2,1-2H3;1H4/t14?,15-;/m1./s1 |
| InChIKey | FVHRUIMBYGAXHJ-NUNOUFIPSA-N |
| XLogP | 1.94 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane?
The IUPAC name of [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane (CID 158152684) is [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane.
What is the SMILES notation for [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane?
The canonical SMILES for [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane is C.C[C@@](O)(COS(C)(=O)=O)c1ccc(COC2CCCCO2)nc1.
What is the InChIKey of [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane?
The InChIKey is FVHRUIMBYGAXHJ-NUNOUFIPSA-N. The full InChI is InChI=1S/C15H23NO6S.CH4/c1-15(17,11-22-23(2,18)19)12-6-7-13(16-9-12)10-21-14-5-3-4-8-20-14;/h6-7,9,14,17H,3-5,8,10-11H2,1-2H3;1H4/t14?,15-;/m1./s1.
What are the key properties of [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane?
[(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane has a molecular weight of 361.46 g/mol, XLogP of 1.94, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-hydroxy-2-[6-(oxan-2-yloxymethyl)-3-pyridinyl]propyl] methanesulfonate;methane is sourced from PubChem (CID 158152684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).