C35H47N5O6 — CID 158153002
4-[5-[1-hydroxy-2-(4-methylpentoxy)ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide (PubChem CID 158153002) has the molecular formula C35H47N5O6 and a molecular weight of 633.79 g/mol. Its IUPAC name is 4-[5-[1-hydroxy-2-(4-methylpentoxy)ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide.
| Compound Name | 4-[5-[1-hydroxy-2-(4-methylpentoxy)ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 158153002 |
| Molecular Formula | C35H47N5O6 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.35 |
| IUPAC Name | 4-[5-[1-hydroxy-2-(4-methylpentoxy)ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide |
| SMILES | CC(C)CCCOCC(O)n1nnc2c1-c1ccccc1N(C(=O)CCC(=O)NCCOCCC(=O)C(C)C)Cc1ccccc1-2 |
| InChI | InChI=1S/C35H47N5O6/c1-24(2)10-9-19-46-23-33(44)40-35-28-13-7-8-14-29(28)39(22-26-11-5-6-12-27(26)34(35)37-38-40)32(43)16-15-31(42)36-18-21-45-20-17-30(41)25(3)4/h5-8,11-14,24-25,33,44H,9-10,15-23H2,1-4H3,(H,36,42) |
| InChIKey | FVIRDJYYPGRKAG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|