C25H40N5O17P3 — CID 158153085
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R)-3-hydroxy-2,2-dimethyl-4,8,12-trioxotridecyl] hydrogen phosphate (PubChem CID 158153085) has the molecular formula C25H40N5O17P3 and a molecular weight of 775.53 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R)-3-hydroxy-2,2-dimethyl-4,8,12-trioxotridecyl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R)-3-hydroxy-2,2-dimethyl-4,8,12-trioxotridecyl] hydrogen phosphate |
|---|---|
| PubChem CID | 158153085 |
| Molecular Formula | C25H40N5O17P3 |
| Molecular Weight | 775.53 g/mol |
| Exact Mass | 775.16 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R)-3-hydroxy-2,2-dimethyl-4,8,12-trioxotridecyl] hydrogen phosphate |
| SMILES | CC(=O)CCCC(=O)CCCC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H40N5O17P3/c1-14(31)6-4-7-15(32)8-5-9-16(33)21(35)25(2,3)11-44-50(41,42)47-49(39,40)43-10-17-20(46-48(36,37)38)19(34)24(45-17)30-13-29-18-22(26)27-12-28-23(18)30/h12-13,17,19-21,24,34-35H,4-11H2,1-3H3,(H,39,40)(H,41,42)(H2,26,27,28)(H2,36,37,38)/t17-,19-,20-,21+,24-/m1/s1 |
| InChIKey | FVIXHRHZWUMOMI-ISPHGWFKSA-N |
| XLogP | 0.85 |
| TPSA | 339.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|