C41H32N6O3S2 — CID 158154346
methyl 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbohydrazide (PubChem CID 158154346) has the molecular formula C41H32N6O3S2 and a molecular weight of 720.88 g/mol. Its IUPAC name is methyl 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbohydrazide.
| Compound Name | methyl 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 158154346 |
| Molecular Formula | C41H32N6O3S2 |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | methyl 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbohydrazide |
| SMILES | COC(=O)c1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1.NNC(=O)c1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C21H16N2O2S.C20H16N4OS/c1-25-21(24)19-11-17-18(12-22-13-20(17)26-19)23-16-9-7-15(8-10-16)14-5-3-2-4-6-14;21-24-20(25)18-10-16-17(11-22-12-19(16)26-18)23-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h2-13,23H,1H3;1-12,23H,21H2,(H,24,25) |
| InChIKey | FVMOIYSQCRTQDG-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|