C45H36N4O3 — CID 158155383
4-[(10Z)-10,20-bis(4-hydroxyphenyl)-15-(4-methylphenyl)-4,5,19,20,22,23-hexahydroporphyrin-5-yl]phenol (PubChem CID 158155383) has the molecular formula C45H36N4O3 and a molecular weight of 680.81 g/mol. Its IUPAC name is 4-[(10Z)-10,20-bis(4-hydroxyphenyl)-15-(4-methylphenyl)-4,5,19,20,22,23-hexahydroporphyrin-5-yl]phenol.
| Compound Name | 4-[(10Z)-10,20-bis(4-hydroxyphenyl)-15-(4-methylphenyl)-4,5,19,20,22,23-hexahydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 158155383 |
| Molecular Formula | C45H36N4O3 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | 4-[(10Z)-10,20-bis(4-hydroxyphenyl)-15-(4-methylphenyl)-4,5,19,20,22,23-hexahydroporphyrin-5-yl]phenol |
| SMILES | Cc1ccc(C2=c3cc/c([nH]3)=C(\c3ccc(O)cc3)c3ccc([nH]3)C(c3ccc(O)cc3)C3C=CC(=N3)C(c3ccc(O)cc3)C3C=CC2=N3)cc1 |
| InChI | InChI=1S/C45H36N4O3/c1-26-2-4-27(5-3-26)42-34-18-20-36(46-34)43(28-6-12-31(50)13-7-28)38-22-24-40(48-38)45(30-10-16-33(52)17-11-30)41-25-23-39(49-41)44(37-21-19-35(42)47-37)29-8-14-32(51)15-9-29/h2-25,36,40,43,45,47,49-52H,1H3/b42-35?,44-37- |
| InChIKey | IOOSMCAYVARVMA-HHQNORBCSA-N |
| XLogP | 6.90 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |