C28H35ClN6O3S — CID 158156752
2-[6-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-7-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl]ethanimidamide (PubChem CID 158156752) has the molecular formula C28H35ClN6O3S and a molecular weight of 571.15 g/mol. Its IUPAC name is 2-[6-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-7-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl]ethanimidamide.
| Compound Name | 2-[6-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-7-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 158156752 |
| Molecular Formula | C28H35ClN6O3S |
| Molecular Weight | 571.15 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2-[6-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-7-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CC1CCc2cc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)C(C)C)n3)c(OC)cc2C1(C)C |
| InChI | InChI=1S/C28H35ClN6O3S/c1-16(2)39(36,37)24-9-7-6-8-21(24)33-26-20(29)15-32-27(35-26)34-22-12-17-10-11-18(13-25(30)31)28(3,4)19(17)14-23(22)38-5/h6-9,12,14-16,18H,10-11,13H2,1-5H3,(H3,30,31)(H2,32,33,34,35) |
| InChIKey | ZMWPQMTZFGFDNR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|