C24H38N12 — CID 158157383
3-amino-N'-[4,6-bis(5-amino-3-tert-butylpyrazol-1-yl)-1,3,5-triazin-2-yl]-4,4-dimethylpent-2-enimidamide (PubChem CID 158157383) has the molecular formula C24H38N12 and a molecular weight of 494.65 g/mol. Its IUPAC name is 3-amino-N'-[4,6-bis(5-amino-3-tert-butylpyrazol-1-yl)-1,3,5-triazin-2-yl]-4,4-dimethylpent-2-enimidamide.
| Compound Name | 3-amino-N'-[4,6-bis(5-amino-3-tert-butylpyrazol-1-yl)-1,3,5-triazin-2-yl]-4,4-dimethylpent-2-enimidamide |
|---|---|
| PubChem CID | 158157383 |
| Molecular Formula | C24H38N12 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | 3-amino-N'-[4,6-bis(5-amino-3-tert-butylpyrazol-1-yl)-1,3,5-triazin-2-yl]-4,4-dimethylpent-2-enimidamide |
| SMILES | CC(C)(C)C(N)=CC(N)=Nc1nc(-n2nc(C(C)(C)C)cc2N)nc(-n2nc(C(C)(C)C)cc2N)n1 |
| InChI | InChI=1S/C24H38N12/c1-22(2,3)13(25)10-16(26)29-19-30-20(35-17(27)11-14(33-35)23(4,5)6)32-21(31-19)36-18(28)12-15(34-36)24(7,8)9/h10-12H,25,27-28H2,1-9H3,(H2,26,29,30,31,32) |
| InChIKey | UVRKJBAWYVPACN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 190.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|