C26H29F3N2O2 — CID 158158926
butyl 5-cyclopropyl-2-[[1-(4,4,4-trifluorobutyl)indol-5-yl]methyl]pyridine-3-carboxylate (PubChem CID 158158926) has the molecular formula C26H29F3N2O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is butyl 5-cyclopropyl-2-[[1-(4,4,4-trifluorobutyl)indol-5-yl]methyl]pyridine-3-carboxylate.
| Compound Name | butyl 5-cyclopropyl-2-[[1-(4,4,4-trifluorobutyl)indol-5-yl]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158158926 |
| Molecular Formula | C26H29F3N2O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | butyl 5-cyclopropyl-2-[[1-(4,4,4-trifluorobutyl)indol-5-yl]methyl]pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc(C2CC2)cnc1Cc1ccc2c(ccn2CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C26H29F3N2O2/c1-2-3-13-33-25(32)22-16-21(19-6-7-19)17-30-23(22)15-18-5-8-24-20(14-18)9-12-31(24)11-4-10-26(27,28)29/h5,8-9,12,14,16-17,19H,2-4,6-7,10-11,13,15H2,1H3 |
| InChIKey | SGHOHRFPAOVFGG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|