C30H38N2O3 — CID 158160062
1-[(E,2S)-2-tert-butyl-6-(4-methylphenyl)-4-oxohept-5-enoyl]-N-methyl-N-phenylpyrrolidine-2-carboxamide (PubChem CID 158160062) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is 1-[(E,2S)-2-tert-butyl-6-(4-methylphenyl)-4-oxohept-5-enoyl]-N-methyl-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-[(E,2S)-2-tert-butyl-6-(4-methylphenyl)-4-oxohept-5-enoyl]-N-methyl-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 158160062 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 1-[(E,2S)-2-tert-butyl-6-(4-methylphenyl)-4-oxohept-5-enoyl]-N-methyl-N-phenylpyrrolidine-2-carboxamide |
| SMILES | C/C(=C\C(=O)C[C@H](C(=O)N1CCCC1C(=O)N(C)c1ccccc1)C(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H38N2O3/c1-21-14-16-23(17-15-21)22(2)19-25(33)20-26(30(3,4)5)28(34)32-18-10-13-27(32)29(35)31(6)24-11-8-7-9-12-24/h7-9,11-12,14-17,19,26-27H,10,13,18,20H2,1-6H3/b22-19+/t26-,27?/m1/s1 |
| InChIKey | ASPIXUNXSRDZPS-ZVCQBHISSA-N |
| XLogP | 5.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|