C15H24F4O5 — CID 158160244
2,2,4-trimethyl-4-(4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl)oxycarbonylhexanoic acid (PubChem CID 158160244) has the molecular formula C15H24F4O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl)oxycarbonylhexanoic acid.
| Compound Name | 2,2,4-trimethyl-4-(4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl)oxycarbonylhexanoic acid |
|---|---|
| PubChem CID | 158160244 |
| Molecular Formula | C15H24F4O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2,2,4-trimethyl-4-(4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl)oxycarbonylhexanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)O)C(=O)OC(C)CC(O)(F)C(F)(F)F |
| InChI | InChI=1S/C15H24F4O5/c1-6-13(5,8-12(3,4)10(20)21)11(22)24-9(2)7-14(16,23)15(17,18)19/h9,23H,6-8H2,1-5H3,(H,20,21) |
| InChIKey | RXHSNSBBKBPJNT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |