C45H88N4 — CID 158160312
1,2,2,6,6-pentamethyl-4-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,2-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]piperidine (PubChem CID 158160312) has the molecular formula C45H88N4 and a molecular weight of 685.23 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,2-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,2-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]piperidine |
|---|---|
| PubChem CID | 158160312 |
| Molecular Formula | C45H88N4 |
| Molecular Weight | 685.23 g/mol |
| Exact Mass | 684.70 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,2-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]piperidine |
| SMILES | CN1C(C)(C)CC(CC(CC2CC(C)(C)N(C)C(C)(C)C2)(CC2CC(C)(C)N(C)C(C)(C)C2)CC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C45H88N4/c1-37(2)21-33(22-38(3,4)46(37)17)29-45(30-34-23-39(5,6)47(18)40(7,8)24-34,31-35-25-41(9,10)48(19)42(11,12)26-35)32-36-27-43(13,14)49(20)44(15,16)28-36/h33-36H,21-32H2,1-20H3 |
| InChIKey | FWEOAUDHRAHHNP-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.23 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |