About 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane
5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane (PubChem CID 158161017) has the molecular formula C26H32Cl2N4
and a molecular weight of 471.48 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane |
| PubChem CID | 158161017 |
| Molecular Formula | C26H32Cl2N4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane |
| SMILES | C.C.C.Cc1cc(-c2ccc(Cl)cc2)cnc1N.Nc1ccc(-c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C12H11ClN2.C11H9ClN2.3CH4/c1-8-6-10(7-15-12(8)14)9-2-4-11(13)5-3-9;12-10-4-1-8(2-5-10)9-3-6-11(13)14-7-9;;;/h2-7H,1H3,(H2,14,15);1-7H,(H2,13,14);3*1H4 |
| InChIKey | FWGSGLYJVLVJOH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane?
The IUPAC name of 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane (CID 158161017) is 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane.
What is the SMILES notation for 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane?
The canonical SMILES for 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane is C.C.C.Cc1cc(-c2ccc(Cl)cc2)cnc1N.Nc1ccc(-c2ccc(Cl)cc2)cn1.
What is the InChIKey of 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane?
The InChIKey is FWGSGLYJVLVJOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2.C11H9ClN2.3CH4/c1-8-6-10(7-15-12(8)14)9-2-4-11(13)5-3-9;12-10-4-1-8(2-5-10)9-3-6-11(13)14-7-9;;;/h2-7H,1H3,(H2,14,15);1-7H,(H2,13,14);3*1H4.
What are the key properties of 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane?
5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane has a molecular weight of 471.48 g/mol, XLogP of 8.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3-methylpyridin-2-amine;5-(4-chlorophenyl)pyridin-2-amine;methane is sourced from PubChem (CID 158161017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).