C32H48FN3O4 — CID 158161045
3-[2-(2-fluoro-5-methylphenyl)ethylamino]-N-[(2R)-hexan-2-yl]-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide;methane (PubChem CID 158161045) has the molecular formula C32H48FN3O4 and a molecular weight of 557.75 g/mol. Its IUPAC name is 3-[2-(2-fluoro-5-methylphenyl)ethylamino]-N-[(2R)-hexan-2-yl]-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide;methane.
| Compound Name | 3-[2-(2-fluoro-5-methylphenyl)ethylamino]-N-[(2R)-hexan-2-yl]-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide;methane |
|---|---|
| PubChem CID | 158161045 |
| Molecular Formula | C32H48FN3O4 |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.36 |
| IUPAC Name | 3-[2-(2-fluoro-5-methylphenyl)ethylamino]-N-[(2R)-hexan-2-yl]-N-[5-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)pentyl]propanamide;methane |
| SMILES | C.CCCC[C@@H](C)N(CCCCCc1ccc(O)c2c1OCC(=O)N2)C(=O)CCNCCc1cc(C)ccc1F |
| InChI | InChI=1S/C31H44FN3O4.CH4/c1-4-5-9-23(3)35(29(38)16-18-33-17-15-25-20-22(2)11-13-26(25)32)19-8-6-7-10-24-12-14-27(36)30-31(24)39-21-28(37)34-30;/h11-14,20,23,33,36H,4-10,15-19,21H2,1-3H3,(H,34,37);1H4/t23-;/m1./s1 |
| InChIKey | FWGVATCNFDAQJI-GNAFDRTKSA-N |
| XLogP | 6.15 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|