About ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+)
ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) (PubChem CID 158162413) has the molecular formula C11H16N2W
and a molecular weight of 360.10 g/mol. Its IUPAC name is ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+).
Molecular Properties
| Compound Name | ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) |
| PubChem CID | 158162413 |
| Molecular Formula | C11H16N2W |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) |
| SMILES | CC.CC/[C-]=N/c1[c-]nccc1C.[W+2] |
| InChI | InChI=1S/C9H10N2.C2H6.W/c1-3-5-11-9-7-10-6-4-8(9)2;1-2;/h4,6H,3H2,1-2H3;1-2H3;/q-2;;+2 |
| InChIKey | XDUZBHHFOSAYSA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+)?
The IUPAC name of ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) (CID 158162413) is ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+).
What is the SMILES notation for ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+)?
The canonical SMILES for ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) is CC.CC/[C-]=N/c1[c-]nccc1C.[W+2].
What is the InChIKey of ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+)?
The InChIKey is XDUZBHHFOSAYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C2H6.W/c1-3-5-11-9-7-10-6-4-8(9)2;1-2;/h4,6H,3H2,1-2H3;1-2H3;/q-2;;+2.
What are the key properties of ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+)?
ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) has a molecular weight of 360.10 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(4-methyl-2H-pyridin-2-id-3-yl)propan-1-imine;tungsten(2+) is sourced from PubChem (CID 158162413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).