C16H26F4O5 — CID 158162791
[1-ethoxy-1-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate (PubChem CID 158162791) has the molecular formula C16H26F4O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is [1-ethoxy-1-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [1-ethoxy-1-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158162791 |
| Molecular Formula | C16H26F4O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [1-ethoxy-1-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(OCCC(F)(F)C(C)(F)F)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C16H26F4O5/c1-7-13(3,4)11(21)25-14(5,12(22)23-8-2)24-10-9-16(19,20)15(6,17)18/h7-10H2,1-6H3 |
| InChIKey | PJUGPQOKNUKJIQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|