C18H9Cl3N4O5 — CID 158162895
6-chloro-3-nitro-1H-quinolin-4-one;4,6-dichloro-3-nitroquinoline (PubChem CID 158162895) has the molecular formula C18H9Cl3N4O5 and a molecular weight of 467.65 g/mol. Its IUPAC name is 6-chloro-3-nitro-1H-quinolin-4-one;4,6-dichloro-3-nitroquinoline.
| Compound Name | 6-chloro-3-nitro-1H-quinolin-4-one;4,6-dichloro-3-nitroquinoline |
|---|---|
| PubChem CID | 158162895 |
| Molecular Formula | C18H9Cl3N4O5 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | 6-chloro-3-nitro-1H-quinolin-4-one;4,6-dichloro-3-nitroquinoline |
| SMILES | O=[N+]([O-])c1cnc2ccc(Cl)cc2c1Cl.O=c1c([N+](=O)[O-])c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C9H4Cl2N2O2.C9H5ClN2O3/c10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15;10-5-1-2-7-6(3-5)9(13)8(4-11-7)12(14)15/h1-4H;1-4H,(H,11,13) |
| InChIKey | FWMMROVXROYYHC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|