About 1-benzofuran;2-benzothiophene
1-benzofuran;2-benzothiophene (PubChem CID 158166060) has the molecular formula C16H12OS
and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-benzofuran;2-benzothiophene.
Molecular Properties
| Compound Name | 1-benzofuran;2-benzothiophene |
| PubChem CID | 158166060 |
| Molecular Formula | C16H12OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-benzofuran;2-benzothiophene |
| SMILES | c1ccc2cscc2c1.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C8H6S/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-8-6-9-5-7(8)3-1/h2*1-6H |
| InChIKey | FWVXGLSNFIPMKO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzofuran;2-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;2-benzothiophene?
The IUPAC name of 1-benzofuran;2-benzothiophene (CID 158166060) is 1-benzofuran;2-benzothiophene.
What is the SMILES notation for 1-benzofuran;2-benzothiophene?
The canonical SMILES for 1-benzofuran;2-benzothiophene is c1ccc2cscc2c1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;2-benzothiophene?
The InChIKey is FWVXGLSNFIPMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C8H6S/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-8-6-9-5-7(8)3-1/h2*1-6H.
What are the key properties of 1-benzofuran;2-benzothiophene?
1-benzofuran;2-benzothiophene has a molecular weight of 252.34 g/mol, XLogP of 5.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;2-benzothiophene is sourced from PubChem (CID 158166060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).