C12H3Cl9O2 — CID 158166722
2,3,4,5,6-pentachlorophenol;2,3,4,6-tetrachlorophenol (PubChem CID 158166722) has the molecular formula C12H3Cl9O2 and a molecular weight of 498.23 g/mol. Its IUPAC name is 2,3,4,5,6-pentachlorophenol;2,3,4,6-tetrachlorophenol.
| Compound Name | 2,3,4,5,6-pentachlorophenol;2,3,4,6-tetrachlorophenol |
|---|---|
| PubChem CID | 158166722 |
| Molecular Formula | C12H3Cl9O2 |
| Molecular Weight | 498.23 g/mol |
| Exact Mass | 493.73 |
| IUPAC Name | 2,3,4,5,6-pentachlorophenol;2,3,4,6-tetrachlorophenol |
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.Oc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O.C6H2Cl4O/c7-1-2(8)4(10)6(12)5(11)3(1)9;7-2-1-3(8)6(11)5(10)4(2)9/h12H;1,11H |
| InChIKey | FWXXNRXPXRWDEA-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.23 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|