About 1H-imidazole;bis(1H-pyrrole)
1H-imidazole;bis(1H-pyrrole) (PubChem CID 158168518) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 1H-imidazole;bis(1H-pyrrole).
Molecular Properties
| Compound Name | 1H-imidazole;bis(1H-pyrrole) |
| PubChem CID | 158168518 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1H-imidazole;bis(1H-pyrrole) |
| SMILES | c1c[nH]cn1.c1cc[nH]c1.c1cc[nH]c1 |
| InChI | InChI=1S/2C4H5N.C3H4N2/c2*1-2-4-5-3-1;1-2-5-3-4-1/h2*1-5H;1-3H,(H,4,5) |
| InChIKey | FXDNNVNZSSQGNO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-imidazole;bis(1H-pyrrole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;bis(1H-pyrrole)?
The IUPAC name of 1H-imidazole;bis(1H-pyrrole) (CID 158168518) is 1H-imidazole;bis(1H-pyrrole).
What is the SMILES notation for 1H-imidazole;bis(1H-pyrrole)?
The canonical SMILES for 1H-imidazole;bis(1H-pyrrole) is c1c[nH]cn1.c1cc[nH]c1.c1cc[nH]c1.
What is the InChIKey of 1H-imidazole;bis(1H-pyrrole)?
The InChIKey is FXDNNVNZSSQGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5N.C3H4N2/c2*1-2-4-5-3-1;1-2-5-3-4-1/h2*1-5H;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;bis(1H-pyrrole)?
1H-imidazole;bis(1H-pyrrole) has a molecular weight of 202.26 g/mol, XLogP of 2.44, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;bis(1H-pyrrole) is sourced from PubChem (CID 158168518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).