About 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid
4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid (PubChem CID 158168826) has the molecular formula C20H17BrF2N2O2
and a molecular weight of 435.27 g/mol. Its IUPAC name is 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid.
Molecular Properties
| Compound Name | 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid |
| PubChem CID | 158168826 |
| Molecular Formula | C20H17BrF2N2O2 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid |
| SMILES | CC(C)(C)c1c(C#N)ccc(Br)c1F.N#Cc1ccc(CC(=O)O)c(F)c1 |
| InChI | InChI=1S/C11H11BrFN.C9H6FNO2/c1-11(2,3)9-7(6-14)4-5-8(12)10(9)13;10-8-3-6(5-11)1-2-7(8)4-9(12)13/h4-5H,1-3H3;1-3H,4H2,(H,12,13) |
| InChIKey | FXEQGLXGRRHUJK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid?
The IUPAC name of 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid (CID 158168826) is 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid.
What is the SMILES notation for 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid?
The canonical SMILES for 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid is CC(C)(C)c1c(C#N)ccc(Br)c1F.N#Cc1ccc(CC(=O)O)c(F)c1.
What is the InChIKey of 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid?
The InChIKey is FXEQGLXGRRHUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFN.C9H6FNO2/c1-11(2,3)9-7(6-14)4-5-8(12)10(9)13;10-8-3-6(5-11)1-2-7(8)4-9(12)13/h4-5H,1-3H3;1-3H,4H2,(H,12,13).
What are the key properties of 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid?
4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid has a molecular weight of 435.27 g/mol, XLogP of 5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-tert-butyl-3-fluorobenzonitrile;2-(4-cyano-2-fluorophenyl)acetic acid is sourced from PubChem (CID 158168826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).