C40H42N8O4S2 — CID 158169462
3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;N-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 158169462) has the molecular formula C40H42N8O4S2 and a molecular weight of 762.96 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;N-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | 3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;N-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 158169462 |
| Molecular Formula | C40H42N8O4S2 |
| Molecular Weight | 762.96 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | 3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;N-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | CN(C)Cc1cc(N)cc(-c2nc3ccncc3s2)c1.COc1cc(C(=O)Nc2cc(CN(C)C)cc(-c3nc4ccncc4s3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N4O4S.C15H16N4S/c1-29(2)14-15-8-17(25-28-19-6-7-26-13-22(19)34-25)10-18(9-15)27-24(30)16-11-20(31-3)23(33-5)21(12-16)32-4;1-19(2)9-10-5-11(7-12(16)6-10)15-18-13-3-4-17-8-14(13)20-15/h6-13H,14H2,1-5H3,(H,27,30);3-8H,9,16H2,1-2H3 |
| InChIKey | FXGQVLWJTDZSJT-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.96 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|