About cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium
cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium (PubChem CID 158170706) has the molecular formula C12H25NO5
and a molecular weight of 263.33 g/mol. Its IUPAC name is cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium |
| PubChem CID | 158170706 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium |
| SMILES | O=C([O-])C1CCCC1.OCC[NH+](CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C6H10O2/c8-4-1-7(2-5-9)3-6-10;7-6(8)5-3-1-2-4-5/h8-10H,1-6H2;5H,1-4H2,(H,7,8) |
| InChIKey | FXKKLQLWMUBYHD-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium?
The IUPAC name of cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium (CID 158170706) is cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium.
What is the SMILES notation for cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium?
The canonical SMILES for cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium is O=C([O-])C1CCCC1.OCC[NH+](CCO)CCO.
What is the InChIKey of cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium?
The InChIKey is FXKKLQLWMUBYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C6H10O2/c8-4-1-7(2-5-9)3-6-10;7-6(8)5-3-1-2-4-5/h8-10H,1-6H2;5H,1-4H2,(H,7,8).
What are the key properties of cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium?
cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium has a molecular weight of 263.33 g/mol, XLogP of -3.23, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanecarboxylate;tris(2-hydroxyethyl)azanium is sourced from PubChem (CID 158170706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).