About 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid
1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid (PubChem CID 158171503) has the molecular formula C11H14F2O6
and a molecular weight of 280.22 g/mol. Its IUPAC name is 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid.
Molecular Properties
| Compound Name | 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid |
| PubChem CID | 158171503 |
| Molecular Formula | C11H14F2O6 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid |
| SMILES | C=C(F)F.C=CC(=O)OCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C9H12O6.C2H2F2/c1-2-8(12)14-5-6-15-9(13)4-3-7(10)11;1-2(3)4/h2H,1,3-6H2,(H,10,11);1H2 |
| InChIKey | FXMWGSTXZHWFBX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid?
The IUPAC name of 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid (CID 158171503) is 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid.
What is the SMILES notation for 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid?
The canonical SMILES for 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid is C=C(F)F.C=CC(=O)OCCOC(=O)CCC(=O)O.
What is the InChIKey of 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid?
The InChIKey is FXMWGSTXZHWFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O6.C2H2F2/c1-2-8(12)14-5-6-15-9(13)4-3-7(10)11;1-2(3)4/h2H,1,3-6H2,(H,10,11);1H2.
What are the key properties of 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid?
1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid has a molecular weight of 280.22 g/mol, XLogP of 1.52, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethene;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid is sourced from PubChem (CID 158171503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).