C30H51FN6O4S2 — CID 158173314
3-(3,3-dimethylcyclopentyl)propan-1-amine;6-[3-(3,3-dimethylcyclopentyl)propylamino]pyridine-2-sulfonamide;6-fluoropyridine-2-sulfonamide (PubChem CID 158173314) has the molecular formula C30H51FN6O4S2 and a molecular weight of 642.91 g/mol. Its IUPAC name is 3-(3,3-dimethylcyclopentyl)propan-1-amine;6-[3-(3,3-dimethylcyclopentyl)propylamino]pyridine-2-sulfonamide;6-fluoropyridine-2-sulfonamide.
| Compound Name | 3-(3,3-dimethylcyclopentyl)propan-1-amine;6-[3-(3,3-dimethylcyclopentyl)propylamino]pyridine-2-sulfonamide;6-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 158173314 |
| Molecular Formula | C30H51FN6O4S2 |
| Molecular Weight | 642.91 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | 3-(3,3-dimethylcyclopentyl)propan-1-amine;6-[3-(3,3-dimethylcyclopentyl)propylamino]pyridine-2-sulfonamide;6-fluoropyridine-2-sulfonamide |
| SMILES | CC1(C)CCC(CCCN)C1.CC1(C)CCC(CCCNc2cccc(S(N)(=O)=O)n2)C1.NS(=O)(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C15H25N3O2S.C10H21N.C5H5FN2O2S/c1-15(2)9-8-12(11-15)5-4-10-17-13-6-3-7-14(18-13)21(16,19)20;1-10(2)6-5-9(8-10)4-3-7-11;6-4-2-1-3-5(8-4)11(7,9)10/h3,6-7,12H,4-5,8-11H2,1-2H3,(H,17,18)(H2,16,19,20);9H,3-8,11H2,1-2H3;1-3H,(H2,7,9,10) |
| InChIKey | FXSFUEWXXOYRFV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 184.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|