About carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one
carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one (PubChem CID 158174374) has the molecular formula C16H14F3N3O3S
and a molecular weight of 385.37 g/mol. Its IUPAC name is carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one |
| PubChem CID | 158174374 |
| Molecular Formula | C16H14F3N3O3S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one |
| SMILES | Cc1csc(N2CCN(Cc3ccc(C(F)(F)F)cc3)C2=O)n1.O=C=O |
| InChI | InChI=1S/C15H14F3N3OS.CO2/c1-10-9-23-13(19-10)21-7-6-20(14(21)22)8-11-2-4-12(5-3-11)15(16,17)18;2-1-3/h2-5,9H,6-8H2,1H3; |
| InChIKey | FXVFUSBIJFYFLV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one?
The IUPAC name of carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one (CID 158174374) is carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one.
What is the SMILES notation for carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one?
The canonical SMILES for carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one is Cc1csc(N2CCN(Cc3ccc(C(F)(F)F)cc3)C2=O)n1.O=C=O.
What is the InChIKey of carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one?
The InChIKey is FXVFUSBIJFYFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3N3OS.CO2/c1-10-9-23-13(19-10)21-7-6-20(14(21)22)8-11-2-4-12(5-3-11)15(16,17)18;2-1-3/h2-5,9H,6-8H2,1H3;.
What are the key properties of carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one?
carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one has a molecular weight of 385.37 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-(4-methyl-1,3-thiazol-2-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-2-one is sourced from PubChem (CID 158174374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).