C21H26ClN7O5S — CID 158175286
5-[3-[[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-[(1S,2S)-2-methylcyclopropyl]-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine (PubChem CID 158175286) has the molecular formula C21H26ClN7O5S and a molecular weight of 524.00 g/mol. Its IUPAC name is 5-[3-[[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-[(1S,2S)-2-methylcyclopropyl]-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine.
| Compound Name | 5-[3-[[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-[(1S,2S)-2-methylcyclopropyl]-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 158175286 |
| Molecular Formula | C21H26ClN7O5S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 5-[3-[[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-[(1S,2S)-2-methylcyclopropyl]-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine |
| SMILES | COc1ncnc(OC)c1-n1c(CS(=O)(=O)[C@@H](C)[C@H](OC)c2ncc(Cl)cn2)nnc1[C@H]1C[C@@H]1C |
| InChI | InChI=1S/C21H26ClN7O5S/c1-11-6-14(11)19-28-27-15(29(19)16-20(33-4)25-10-26-21(16)34-5)9-35(30,31)12(2)17(32-3)18-23-7-13(22)8-24-18/h7-8,10-12,14,17H,6,9H2,1-5H3/t11-,12-,14-,17-/m0/s1 |
| InChIKey | FJTXGKRHGPKUQR-GWIFVGGISA-N |
| XLogP | 2.33 |
| TPSA | 144.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |