C26H36N4O5S — CID 158176362
4-amino-3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-5-N-(2-oxoheptyl)-1,2-thiazole-3,5-dicarboxamide (PubChem CID 158176362) has the molecular formula C26H36N4O5S and a molecular weight of 516.66 g/mol. Its IUPAC name is 4-amino-3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-5-N-(2-oxoheptyl)-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-5-N-(2-oxoheptyl)-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 158176362 |
| Molecular Formula | C26H36N4O5S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-amino-3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-5-N-(2-oxoheptyl)-1,2-thiazole-3,5-dicarboxamide |
| SMILES | CCCCCC(=O)CN(C(=O)c1snc(C(=O)NC2CCCCC2)c1N)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H36N4O5S/c1-4-5-7-12-18(31)16-30(20-14-13-19(34-2)15-21(20)35-3)26(33)24-22(27)23(29-36-24)25(32)28-17-10-8-6-9-11-17/h13-15,17H,4-12,16,27H2,1-3H3,(H,28,32) |
| InChIKey | ZHMRALUHQLTNIH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|