C29H33BClFO6S — CID 158177808
[(2S,4S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]-5-oxohexyl]-methylborinic acid (PubChem CID 158177808) has the molecular formula C29H33BClFO6S and a molecular weight of 574.91 g/mol. Its IUPAC name is [(2S,4S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]-5-oxohexyl]-methylborinic acid.
| Compound Name | [(2S,4S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]-5-oxohexyl]-methylborinic acid |
|---|---|
| PubChem CID | 158177808 |
| Molecular Formula | C29H33BClFO6S |
| Molecular Weight | 574.91 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | [(2S,4S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]-5-oxohexyl]-methylborinic acid |
| SMILES | COCC(=O)[C@H](COS(=O)(=O)c1ccc(C)cc1)C[C@H](CB(C)O)Cc1ccc(-c2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C29H33BClFO6S/c1-20-4-11-26(12-5-20)39(35,36)38-18-24(29(33)19-37-3)15-22(17-30(2)34)14-21-6-8-23(9-7-21)27-16-25(31)10-13-28(27)32/h4-13,16,22,24,34H,14-15,17-19H2,1-3H3/t22-,24+/m1/s1 |
| InChIKey | QPSKBXNUZHNTDN-VWNXMTODSA-N |
| XLogP | 5.85 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.91 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|