About 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium
2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium (PubChem CID 158178011) has the molecular formula C18H21N2+
and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium.
Molecular Properties
| Compound Name | 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium |
| PubChem CID | 158178011 |
| Molecular Formula | C18H21N2+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium |
| SMILES | Cc1ccc(C)c(-c2n(C)c3cc(C)ccc3[n+]2C)c1 |
| InChI | InChI=1S/C18H21N2/c1-12-6-8-14(3)15(10-12)18-19(4)16-9-7-13(2)11-17(16)20(18)5/h6-11H,1-5H3/q+1 |
| InChIKey | BWSCOGGCSKRORX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium?
The IUPAC name of 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium (CID 158178011) is 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium.
What is the SMILES notation for 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium?
The canonical SMILES for 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium is Cc1ccc(C)c(-c2n(C)c3cc(C)ccc3[n+]2C)c1.
What is the InChIKey of 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium?
The InChIKey is BWSCOGGCSKRORX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N2/c1-12-6-8-14(3)15(10-12)18-19(4)16-9-7-13(2)11-17(16)20(18)5/h6-11H,1-5H3/q+1.
What are the key properties of 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium?
2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium has a molecular weight of 265.38 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylphenyl)-1,3,5-trimethylbenzimidazol-1-ium is sourced from PubChem (CID 158178011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).