2H-1,4-benzothiazine;methanesulfonic acid

C9H11NO3S2 — CID 158178110

IUPAC2H-1,4-benzothiazine;methanesulfonic acid
SMILESC1=Nc2ccccc2SC1.CS(=O)(=O)O
InChIInChI=1S/C8H7NS.CH4O3S/c1-2-4-8-7(3-1)9-5-6-10-8;1-5(2,3)4/h1-5H,6H2;1H3,(H,2,3,4)
InChIKeyFYGAELJRMDBYQE-UHFFFAOYSA-N
MW245.32 g/mol
LogP2.00
Rot. Bonds

About 2H-1,4-benzothiazine;methanesulfonic acid

2H-1,4-benzothiazine;methanesulfonic acid (PubChem CID 158178110) has the molecular formula C9H11NO3S2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2H-1,4-benzothiazine;methanesulfonic acid.

Molecular Properties

Compound Name2H-1,4-benzothiazine;methanesulfonic acid
PubChem CID158178110
Molecular FormulaC9H11NO3S2
Molecular Weight245.32 g/mol
Exact Mass245.02
IUPAC Name2H-1,4-benzothiazine;methanesulfonic acid
SMILESC1=Nc2ccccc2SC1.CS(=O)(=O)O
InChIInChI=1S/C8H7NS.CH4O3S/c1-2-4-8-7(3-1)9-5-6-10-8;1-5(2,3)4/h1-5H,6H2;1H3,(H,2,3,4)
InChIKeyFYGAELJRMDBYQE-UHFFFAOYSA-N
XLogP2.00
TPSA66.73 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.32
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2H-1,4-benzothiazine;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2H-1,4-benzothiazine;methanesulfonic acid?
The IUPAC name of 2H-1,4-benzothiazine;methanesulfonic acid (CID 158178110) is 2H-1,4-benzothiazine;methanesulfonic acid.
What is the SMILES notation for 2H-1,4-benzothiazine;methanesulfonic acid?
The canonical SMILES for 2H-1,4-benzothiazine;methanesulfonic acid is C1=Nc2ccccc2SC1.CS(=O)(=O)O.
What is the InChIKey of 2H-1,4-benzothiazine;methanesulfonic acid?
The InChIKey is FYGAELJRMDBYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.CH4O3S/c1-2-4-8-7(3-1)9-5-6-10-8;1-5(2,3)4/h1-5H,6H2;1H3,(H,2,3,4).
What are the key properties of 2H-1,4-benzothiazine;methanesulfonic acid?
2H-1,4-benzothiazine;methanesulfonic acid has a molecular weight of 245.32 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,4-benzothiazine;methanesulfonic acid is sourced from PubChem (CID 158178110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).