About 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione
2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione (PubChem CID 158178934) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione.
Molecular Properties
| Compound Name | 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione |
| PubChem CID | 158178934 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C8H18O2.C5H8O2/c1-7(2,3)9-10-8(4,5)6;1-4(6)3-5(2)7/h1-6H3;3H2,1-2H3 |
| InChIKey | FYINXUWMAYAHJK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione?
The IUPAC name of 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione (CID 158178934) is 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione.
What is the SMILES notation for 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione?
The canonical SMILES for 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione is CC(=O)CC(C)=O.CC(C)(C)OOC(C)(C)C.
What is the InChIKey of 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione?
The InChIKey is FYINXUWMAYAHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C5H8O2/c1-7(2,3)9-10-8(4,5)6;1-4(6)3-5(2)7/h1-6H3;3H2,1-2H3.
What are the key properties of 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione?
2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione has a molecular weight of 246.35 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylperoxy-2-methylpropane;pentane-2,4-dione is sourced from PubChem (CID 158178934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).