C26H25F2NO5S — CID 158179242
4-[4-[4-(1-benzothiophene-2-carbonylamino)butanoyl]-3,5-difluorophenoxy]cyclohexane-1-carboxylic acid (PubChem CID 158179242) has the molecular formula C26H25F2NO5S and a molecular weight of 501.55 g/mol. Its IUPAC name is 4-[4-[4-(1-benzothiophene-2-carbonylamino)butanoyl]-3,5-difluorophenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-(1-benzothiophene-2-carbonylamino)butanoyl]-3,5-difluorophenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 158179242 |
| Molecular Formula | C26H25F2NO5S |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-[4-[4-(1-benzothiophene-2-carbonylamino)butanoyl]-3,5-difluorophenoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCCCC(=O)c1c(F)cc(OC2CCC(C(=O)O)CC2)cc1F)c1cc2ccccc2s1 |
| InChI | InChI=1S/C26H25F2NO5S/c27-19-13-18(34-17-9-7-15(8-10-17)26(32)33)14-20(28)24(19)21(30)5-3-11-29-25(31)23-12-16-4-1-2-6-22(16)35-23/h1-2,4,6,12-15,17H,3,5,7-11H2,(H,29,31)(H,32,33) |
| InChIKey | FYJIUNSICXAVPQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|